C12H23N3O — CID 106452722
3,5-diethyl-1-(2-propoxyethyl)pyrazol-4-amine (PubChem CID 106452722) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is 3,5-diethyl-1-(2-propoxyethyl)pyrazol-4-amine.
| Compound Name | 3,5-diethyl-1-(2-propoxyethyl)pyrazol-4-amine |
|---|---|
| PubChem CID | 106452722 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | 3,5-diethyl-1-(2-propoxyethyl)pyrazol-4-amine |
| SMILES | CCCOCCn1nc(CC)c(N)c1CC |
| InChI | InChI=1S/C12H23N3O/c1-4-8-16-9-7-15-11(6-3)12(13)10(5-2)14-15/h4-9,13H2,1-3H3 |
| InChIKey | MXOYBWISTMQFNY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|