C12H23N3O2S — CID 82702521
3,5-diethyl-1-(3-ethylsulfonylpropyl)pyrazol-4-amine (PubChem CID 82702521) has the molecular formula C12H23N3O2S and a molecular weight of 273.40 g/mol. Its IUPAC name is 3,5-diethyl-1-(3-ethylsulfonylpropyl)pyrazol-4-amine.
| Compound Name | 3,5-diethyl-1-(3-ethylsulfonylpropyl)pyrazol-4-amine |
|---|---|
| PubChem CID | 82702521 |
| Molecular Formula | C12H23N3O2S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 3,5-diethyl-1-(3-ethylsulfonylpropyl)pyrazol-4-amine |
| SMILES | CCc1nn(CCCS(=O)(=O)CC)c(CC)c1N |
| InChI | InChI=1S/C12H23N3O2S/c1-4-10-12(13)11(5-2)15(14-10)8-7-9-18(16,17)6-3/h4-9,13H2,1-3H3 |
| InChIKey | XDQOBRUFXITVLF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |