About 1-(2-butoxyethyl)-3,5-diethylpyrazol-4-amine
1-(2-butoxyethyl)-3,5-diethylpyrazol-4-amine (PubChem CID 82702120) has the molecular formula C13H25N3O
and a molecular weight of 239.36 g/mol. Its IUPAC name is 1-(2-butoxyethyl)-3,5-diethylpyrazol-4-amine.
Molecular Properties
| Compound Name | 1-(2-butoxyethyl)-3,5-diethylpyrazol-4-amine |
| PubChem CID | 82702120 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | 1-(2-butoxyethyl)-3,5-diethylpyrazol-4-amine |
| SMILES | CCCCOCCn1nc(CC)c(N)c1CC |
| InChI | InChI=1S/C13H25N3O/c1-4-7-9-17-10-8-16-12(6-3)13(14)11(5-2)15-16/h4-10,14H2,1-3H3 |
| InChIKey | GFCITRVJQXWKHQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-butoxyethyl)-3,5-diethylpyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-butoxyethyl)-3,5-diethylpyrazol-4-amine?
The IUPAC name of 1-(2-butoxyethyl)-3,5-diethylpyrazol-4-amine (CID 82702120) is 1-(2-butoxyethyl)-3,5-diethylpyrazol-4-amine.
What is the SMILES notation for 1-(2-butoxyethyl)-3,5-diethylpyrazol-4-amine?
The canonical SMILES for 1-(2-butoxyethyl)-3,5-diethylpyrazol-4-amine is CCCCOCCn1nc(CC)c(N)c1CC.
What is the InChIKey of 1-(2-butoxyethyl)-3,5-diethylpyrazol-4-amine?
The InChIKey is GFCITRVJQXWKHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N3O/c1-4-7-9-17-10-8-16-12(6-3)13(14)11(5-2)15-16/h4-10,14H2,1-3H3.
What are the key properties of 1-(2-butoxyethyl)-3,5-diethylpyrazol-4-amine?
1-(2-butoxyethyl)-3,5-diethylpyrazol-4-amine has a molecular weight of 239.36 g/mol, XLogP of 2.41, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-butoxyethyl)-3,5-diethylpyrazol-4-amine is sourced from PubChem (CID 82702120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).