C12H23N3O2 — CID 82702606
3,5-diethyl-1-[2-(2-methoxyethoxy)ethyl]pyrazol-4-amine (PubChem CID 82702606) has the molecular formula C12H23N3O2 and a molecular weight of 241.33 g/mol. Its IUPAC name is 3,5-diethyl-1-[2-(2-methoxyethoxy)ethyl]pyrazol-4-amine.
| Compound Name | 3,5-diethyl-1-[2-(2-methoxyethoxy)ethyl]pyrazol-4-amine |
|---|---|
| PubChem CID | 82702606 |
| Molecular Formula | C12H23N3O2 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 3,5-diethyl-1-[2-(2-methoxyethoxy)ethyl]pyrazol-4-amine |
| SMILES | CCc1nn(CCOCCOC)c(CC)c1N |
| InChI | InChI=1S/C12H23N3O2/c1-4-10-12(13)11(5-2)15(14-10)6-7-17-9-8-16-3/h4-9,13H2,1-3H3 |
| InChIKey | VZXUCWREECKIIM-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|