methyl 2-(4-amino-3,5-diethylpyrazol-1-yl)acetate

C10H17N3O2 — CID 82703075

IUPACmethyl 2-(4-amino-3,5-diethylpyrazol-1-yl)acetate
SMILESCCc1nn(CC(=O)OC)c(CC)c1N
InChIInChI=1S/C10H17N3O2/c1-4-7-10(11)8(5-2)13(12-7)6-9(14)15-3/h4-6,11H2,1-3H3
InChIKeyGJBZMKVERLDFJI-UHFFFAOYSA-N
MW211.26 g/mol
LogP0.76
Rot. Bonds4

About methyl 2-(4-amino-3,5-diethylpyrazol-1-yl)acetate

methyl 2-(4-amino-3,5-diethylpyrazol-1-yl)acetate (PubChem CID 82703075) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is methyl 2-(4-amino-3,5-diethylpyrazol-1-yl)acetate.

Molecular Properties

Compound Namemethyl 2-(4-amino-3,5-diethylpyrazol-1-yl)acetate
PubChem CID82703075
Molecular FormulaC10H17N3O2
Molecular Weight211.26 g/mol
Exact Mass211.13
IUPAC Namemethyl 2-(4-amino-3,5-diethylpyrazol-1-yl)acetate
SMILESCCc1nn(CC(=O)OC)c(CC)c1N
InChIInChI=1S/C10H17N3O2/c1-4-7-10(11)8(5-2)13(12-7)6-9(14)15-3/h4-6,11H2,1-3H3
InChIKeyGJBZMKVERLDFJI-UHFFFAOYSA-N
XLogP0.76
TPSA70.14 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500211.26
LogP ≤ 50.76
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 2-(4-amino-3,5-diethylpyrazol-1-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(4-amino-3,5-diethylpyrazol-1-yl)acetate?
The IUPAC name of methyl 2-(4-amino-3,5-diethylpyrazol-1-yl)acetate (CID 82703075) is methyl 2-(4-amino-3,5-diethylpyrazol-1-yl)acetate.
What is the SMILES notation for methyl 2-(4-amino-3,5-diethylpyrazol-1-yl)acetate?
The canonical SMILES for methyl 2-(4-amino-3,5-diethylpyrazol-1-yl)acetate is CCc1nn(CC(=O)OC)c(CC)c1N.
What is the InChIKey of methyl 2-(4-amino-3,5-diethylpyrazol-1-yl)acetate?
The InChIKey is GJBZMKVERLDFJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O2/c1-4-7-10(11)8(5-2)13(12-7)6-9(14)15-3/h4-6,11H2,1-3H3.
What are the key properties of methyl 2-(4-amino-3,5-diethylpyrazol-1-yl)acetate?
methyl 2-(4-amino-3,5-diethylpyrazol-1-yl)acetate has a molecular weight of 211.26 g/mol, XLogP of 0.76, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4-amino-3,5-diethylpyrazol-1-yl)acetate is sourced from PubChem (CID 82703075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).