C16H21N3O2 — CID 82692563
methyl 4-[(4-amino-3,5-diethylpyrazol-1-yl)methyl]benzoate (PubChem CID 82692563) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is methyl 4-[(4-amino-3,5-diethylpyrazol-1-yl)methyl]benzoate.
| Compound Name | methyl 4-[(4-amino-3,5-diethylpyrazol-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 82692563 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | methyl 4-[(4-amino-3,5-diethylpyrazol-1-yl)methyl]benzoate |
| SMILES | CCc1nn(Cc2ccc(C(=O)OC)cc2)c(CC)c1N |
| InChI | InChI=1S/C16H21N3O2/c1-4-13-15(17)14(5-2)19(18-13)10-11-6-8-12(9-7-11)16(20)21-3/h6-9H,4-5,10,17H2,1-3H3 |
| InChIKey | HOCUSHHZMBTWBF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |