C12H21ClN2 — CID 82700348
1-butyl-4-(chloromethyl)-3,5-diethylpyrazole (PubChem CID 82700348) has the molecular formula C12H21ClN2 and a molecular weight of 228.77 g/mol. Its IUPAC name is 1-butyl-4-(chloromethyl)-3,5-diethylpyrazole.
| Compound Name | 1-butyl-4-(chloromethyl)-3,5-diethylpyrazole |
|---|---|
| PubChem CID | 82700348 |
| Molecular Formula | C12H21ClN2 |
| Molecular Weight | 228.77 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 1-butyl-4-(chloromethyl)-3,5-diethylpyrazole |
| SMILES | CCCCn1nc(CC)c(CCl)c1CC |
| InChI | InChI=1S/C12H21ClN2/c1-4-7-8-15-12(6-3)10(9-13)11(5-2)14-15/h4-9H2,1-3H3 |
| InChIKey | ORAXQTXNBOYUKB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.77 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|