C13H23ClN2O — CID 82699042
4-(chloromethyl)-3,5-diethyl-1-(2-propan-2-yloxyethyl)pyrazole (PubChem CID 82699042) has the molecular formula C13H23ClN2O and a molecular weight of 258.79 g/mol. Its IUPAC name is 4-(chloromethyl)-3,5-diethyl-1-(2-propan-2-yloxyethyl)pyrazole.
| Compound Name | 4-(chloromethyl)-3,5-diethyl-1-(2-propan-2-yloxyethyl)pyrazole |
|---|---|
| PubChem CID | 82699042 |
| Molecular Formula | C13H23ClN2O |
| Molecular Weight | 258.79 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 4-(chloromethyl)-3,5-diethyl-1-(2-propan-2-yloxyethyl)pyrazole |
| SMILES | CCc1nn(CCOC(C)C)c(CC)c1CCl |
| InChI | InChI=1S/C13H23ClN2O/c1-5-12-11(9-14)13(6-2)16(15-12)7-8-17-10(3)4/h10H,5-9H2,1-4H3 |
| InChIKey | TYCMZLYUAXYYJA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.79 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|