About methyl 3-(3-amino-5-bromo-1,2,4-triazol-1-yl)propanoate
methyl 3-(3-amino-5-bromo-1,2,4-triazol-1-yl)propanoate (PubChem CID 103098621) has the molecular formula C6H9BrN4O2
and a molecular weight of 249.07 g/mol. Its IUPAC name is methyl 3-(3-amino-5-bromo-1,2,4-triazol-1-yl)propanoate.
Analyze methyl 3-(3-amino-5-bromo-1,2,4-triazol-1-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(3-amino-5-bromo-1,2,4-triazol-1-yl)propanoate?
The IUPAC name of methyl 3-(3-amino-5-bromo-1,2,4-triazol-1-yl)propanoate (CID 103098621) is methyl 3-(3-amino-5-bromo-1,2,4-triazol-1-yl)propanoate.
What is the SMILES notation for methyl 3-(3-amino-5-bromo-1,2,4-triazol-1-yl)propanoate?
The canonical SMILES for methyl 3-(3-amino-5-bromo-1,2,4-triazol-1-yl)propanoate is COC(=O)CCn1nc(N)nc1Br.
What is the InChIKey of methyl 3-(3-amino-5-bromo-1,2,4-triazol-1-yl)propanoate?
The InChIKey is IRFXHRCWSAXVGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9BrN4O2/c1-13-4(12)2-3-11-5(7)9-6(8)10-11/h2-3H2,1H3,(H2,8,10).
What are the key properties of methyl 3-(3-amino-5-bromo-1,2,4-triazol-1-yl)propanoate?
methyl 3-(3-amino-5-bromo-1,2,4-triazol-1-yl)propanoate has a molecular weight of 249.07 g/mol, XLogP of 0.19, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3-amino-5-bromo-1,2,4-triazol-1-yl)propanoate is sourced from PubChem (CID 103098621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).