C19H18N2O2 — CID 14723696
methyl 3-(4,5-diphenylpyrazol-1-yl)propanoate (PubChem CID 14723696) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is methyl 3-(4,5-diphenylpyrazol-1-yl)propanoate.
| Compound Name | methyl 3-(4,5-diphenylpyrazol-1-yl)propanoate |
|---|---|
| PubChem CID | 14723696 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | methyl 3-(4,5-diphenylpyrazol-1-yl)propanoate |
| SMILES | COC(=O)CCn1ncc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C19H18N2O2/c1-23-18(22)12-13-21-19(16-10-6-3-7-11-16)17(14-20-21)15-8-4-2-5-9-15/h2-11,14H,12-13H2,1H3 |
| InChIKey | CYMOVQGKVWWGFN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |