C33H40N2O3 — CID 19982292
methyl 11-(3,4,5-triphenylpyrazol-1-yl)undecanoate;hydrate (PubChem CID 19982292) has the molecular formula C33H40N2O3 and a molecular weight of 512.69 g/mol. Its IUPAC name is methyl 11-(3,4,5-triphenylpyrazol-1-yl)undecanoate;hydrate.
| Compound Name | methyl 11-(3,4,5-triphenylpyrazol-1-yl)undecanoate;hydrate |
|---|---|
| PubChem CID | 19982292 |
| Molecular Formula | C33H40N2O3 |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.30 |
| IUPAC Name | methyl 11-(3,4,5-triphenylpyrazol-1-yl)undecanoate;hydrate |
| SMILES | COC(=O)CCCCCCCCCCn1nc(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1.O |
| InChI | InChI=1S/C33H38N2O2.H2O/c1-37-30(36)25-17-6-4-2-3-5-7-18-26-35-33(29-23-15-10-16-24-29)31(27-19-11-8-12-20-27)32(34-35)28-21-13-9-14-22-28;/h8-16,19-24H,2-7,17-18,25-26H2,1H3;1H2 |
| InChIKey | UKJZODZXAGZBFC-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 75.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|