About methyl 11-(3,4,5-triphenylpyrazol-1-yl)undecanoate;hydrate
methyl 11-(3,4,5-triphenylpyrazol-1-yl)undecanoate;hydrate (PubChem CID 19982292) has the molecular formula C33H40N2O3
and a molecular weight of 512.69 g/mol. Its IUPAC name is methyl 11-(3,4,5-triphenylpyrazol-1-yl)undecanoate;hydrate.
Molecular Properties
| Compound Name | methyl 11-(3,4,5-triphenylpyrazol-1-yl)undecanoate;hydrate |
| PubChem CID | 19982292 |
| Molecular Formula | C33H40N2O3 |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.30 |
| IUPAC Name | methyl 11-(3,4,5-triphenylpyrazol-1-yl)undecanoate;hydrate |
| SMILES | COC(=O)CCCCCCCCCCn1nc(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1.O |
| InChI | InChI=1S/C33H38N2O2.H2O/c1-37-30(36)25-17-6-4-2-3-5-7-18-26-35-33(29-23-15-10-16-24-29)31(27-19-11-8-12-20-27)32(34-35)28-21-13-9-14-22-28;/h8-16,19-24H,2-7,17-18,25-26H2,1H3;1H2 |
| InChIKey | UKJZODZXAGZBFC-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 75.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 11-(3,4,5-triphenylpyrazol-1-yl)undecanoate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 11-(3,4,5-triphenylpyrazol-1-yl)undecanoate;hydrate?
The IUPAC name of methyl 11-(3,4,5-triphenylpyrazol-1-yl)undecanoate;hydrate (CID 19982292) is methyl 11-(3,4,5-triphenylpyrazol-1-yl)undecanoate;hydrate.
What is the SMILES notation for methyl 11-(3,4,5-triphenylpyrazol-1-yl)undecanoate;hydrate?
The canonical SMILES for methyl 11-(3,4,5-triphenylpyrazol-1-yl)undecanoate;hydrate is COC(=O)CCCCCCCCCCn1nc(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1.O.
What is the InChIKey of methyl 11-(3,4,5-triphenylpyrazol-1-yl)undecanoate;hydrate?
The InChIKey is UKJZODZXAGZBFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H38N2O2.H2O/c1-37-30(36)25-17-6-4-2-3-5-7-18-26-35-33(29-23-15-10-16-24-29)31(27-19-11-8-12-20-27)32(34-35)28-21-13-9-14-22-28;/h8-16,19-24H,2-7,17-18,25-26H2,1H3;1H2.
What are the key properties of methyl 11-(3,4,5-triphenylpyrazol-1-yl)undecanoate;hydrate?
methyl 11-(3,4,5-triphenylpyrazol-1-yl)undecanoate;hydrate has a molecular weight of 512.69 g/mol, XLogP of 7.74, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 11-(3,4,5-triphenylpyrazol-1-yl)undecanoate;hydrate is sourced from PubChem (CID 19982292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).