C24H27NO3S — CID 15228842
methyl 8-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]octanoate (PubChem CID 15228842) has the molecular formula C24H27NO3S and a molecular weight of 409.55 g/mol. Its IUPAC name is methyl 8-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]octanoate.
| Compound Name | methyl 8-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]octanoate |
|---|---|
| PubChem CID | 15228842 |
| Molecular Formula | C24H27NO3S |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | methyl 8-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]octanoate |
| SMILES | COC(=O)CCCCCCCSc1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C24H27NO3S/c1-27-21(26)17-11-3-2-4-12-18-29-24-25-22(19-13-7-5-8-14-19)23(28-24)20-15-9-6-10-16-20/h5-10,13-16H,2-4,11-12,17-18H2,1H3 |
| InChIKey | MIOAXDJJYHOHST-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|