methyl 8-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]octanoate

C24H27NO3S — CID 15228842

IUPACmethyl 8-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]octanoate
SMILESCOC(=O)CCCCCCCSc1nc(-c2ccccc2)c(-c2ccccc2)o1
InChIInChI=1S/C24H27NO3S/c1-27-21(26)17-11-3-2-4-12-18-29-24-25-22(19-13-7-5-8-14-19)23(28-24)20-15-9-6-10-16-20/h5-10,13-16H,2-4,11-12,17-18H2,1H3
InChIKeyMIOAXDJJYHOHST-UHFFFAOYSA-N
MW409.55 g/mol
LogP6.61
Rot. Bonds11

About methyl 8-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]octanoate

methyl 8-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]octanoate (PubChem CID 15228842) has the molecular formula C24H27NO3S and a molecular weight of 409.55 g/mol. Its IUPAC name is methyl 8-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]octanoate.

Molecular Properties

Compound Namemethyl 8-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]octanoate
PubChem CID15228842
Molecular FormulaC24H27NO3S
Molecular Weight409.55 g/mol
Exact Mass409.17
IUPAC Namemethyl 8-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]octanoate
SMILESCOC(=O)CCCCCCCSc1nc(-c2ccccc2)c(-c2ccccc2)o1
InChIInChI=1S/C24H27NO3S/c1-27-21(26)17-11-3-2-4-12-18-29-24-25-22(19-13-7-5-8-14-19)23(28-24)20-15-9-6-10-16-20/h5-10,13-16H,2-4,11-12,17-18H2,1H3
InChIKeyMIOAXDJJYHOHST-UHFFFAOYSA-N
XLogP6.61
TPSA52.33 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds11
Heavy Atoms29
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500409.55
LogP ≤ 56.61
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methyl 8-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]octanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 8-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]octanoate?
The IUPAC name of methyl 8-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]octanoate (CID 15228842) is methyl 8-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]octanoate.
What is the SMILES notation for methyl 8-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]octanoate?
The canonical SMILES for methyl 8-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]octanoate is COC(=O)CCCCCCCSc1nc(-c2ccccc2)c(-c2ccccc2)o1.
What is the InChIKey of methyl 8-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]octanoate?
The InChIKey is MIOAXDJJYHOHST-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27NO3S/c1-27-21(26)17-11-3-2-4-12-18-29-24-25-22(19-13-7-5-8-14-19)23(28-24)20-15-9-6-10-16-20/h5-10,13-16H,2-4,11-12,17-18H2,1H3.
What are the key properties of methyl 8-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]octanoate?
methyl 8-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]octanoate has a molecular weight of 409.55 g/mol, XLogP of 6.61, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]octanoate is sourced from PubChem (CID 15228842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).