C18H14F3NOS — CID 134066741
4,5-diphenyl-2-(3,3,3-trifluoropropylsulfanyl)-1,3-oxazole (PubChem CID 134066741) has the molecular formula C18H14F3NOS and a molecular weight of 349.38 g/mol. Its IUPAC name is 4,5-diphenyl-2-(3,3,3-trifluoropropylsulfanyl)-1,3-oxazole.
| Compound Name | 4,5-diphenyl-2-(3,3,3-trifluoropropylsulfanyl)-1,3-oxazole |
|---|---|
| PubChem CID | 134066741 |
| Molecular Formula | C18H14F3NOS |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 4,5-diphenyl-2-(3,3,3-trifluoropropylsulfanyl)-1,3-oxazole |
| SMILES | FC(F)(F)CCSc1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C18H14F3NOS/c19-18(20,21)11-12-24-17-22-15(13-7-3-1-4-8-13)16(23-17)14-9-5-2-6-10-14/h1-10H,11-12H2 |
| InChIKey | CNSBLBGBFXCZGT-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |