C20H19NO2S — CID 43834769
2-(oxolan-2-ylmethylsulfanyl)-4,5-diphenyl-1,3-oxazole (PubChem CID 43834769) has the molecular formula C20H19NO2S and a molecular weight of 337.44 g/mol. Its IUPAC name is 2-(oxolan-2-ylmethylsulfanyl)-4,5-diphenyl-1,3-oxazole.
| Compound Name | 2-(oxolan-2-ylmethylsulfanyl)-4,5-diphenyl-1,3-oxazole |
|---|---|
| PubChem CID | 43834769 |
| Molecular Formula | C20H19NO2S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 2-(oxolan-2-ylmethylsulfanyl)-4,5-diphenyl-1,3-oxazole |
| SMILES | c1ccc(-c2nc(SCC3CCCO3)oc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H19NO2S/c1-3-8-15(9-4-1)18-19(16-10-5-2-6-11-16)23-20(21-18)24-14-17-12-7-13-22-17/h1-6,8-11,17H,7,12-14H2 |
| InChIKey | YLVVDOZLECTXCK-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |