C17H18OS — CID 60518989
2-[(4-phenylphenyl)sulfanylmethyl]oxolane (PubChem CID 60518989) has the molecular formula C17H18OS and a molecular weight of 270.40 g/mol. Its IUPAC name is 2-[(4-phenylphenyl)sulfanylmethyl]oxolane.
| Compound Name | 2-[(4-phenylphenyl)sulfanylmethyl]oxolane |
|---|---|
| PubChem CID | 60518989 |
| Molecular Formula | C17H18OS |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 2-[(4-phenylphenyl)sulfanylmethyl]oxolane |
| SMILES | c1ccc(-c2ccc(SCC3CCCO3)cc2)cc1 |
| InChI | InChI=1S/C17H18OS/c1-2-5-14(6-3-1)15-8-10-17(11-9-15)19-13-16-7-4-12-18-16/h1-3,5-6,8-11,16H,4,7,12-13H2 |
| InChIKey | ZDXAVTDLKWSCAI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |