C13H13N3O4S — CID 1467914
2-(3-nitrophenyl)-5-[[(2R)-oxolan-2-yl]methylsulfanyl]-1,3,4-oxadiazole (PubChem CID 1467914) has the molecular formula C13H13N3O4S and a molecular weight of 307.33 g/mol. Its IUPAC name is 2-(3-nitrophenyl)-5-[[(2R)-oxolan-2-yl]methylsulfanyl]-1,3,4-oxadiazole.
| Compound Name | 2-(3-nitrophenyl)-5-[[(2R)-oxolan-2-yl]methylsulfanyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 1467914 |
| Molecular Formula | C13H13N3O4S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 2-(3-nitrophenyl)-5-[[(2R)-oxolan-2-yl]methylsulfanyl]-1,3,4-oxadiazole |
| SMILES | O=[N+]([O-])c1cccc(-c2nnc(SC[C@H]3CCCO3)o2)c1 |
| InChI | InChI=1S/C13H13N3O4S/c17-16(18)10-4-1-3-9(7-10)12-14-15-13(20-12)21-8-11-5-2-6-19-11/h1,3-4,7,11H,2,5-6,8H2/t11-/m1/s1 |
| InChIKey | YEDJBPANHTWGNC-LLVKDONJSA-N |
| XLogP | 2.92 |
| TPSA | 91.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|