C17H10N6O6S — CID 166436144
2-(3-nitrophenyl)-5-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-1,3,4-oxadiazole (PubChem CID 166436144) has the molecular formula C17H10N6O6S and a molecular weight of 426.37 g/mol. Its IUPAC name is 2-(3-nitrophenyl)-5-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-1,3,4-oxadiazole.
| Compound Name | 2-(3-nitrophenyl)-5-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 166436144 |
| Molecular Formula | C17H10N6O6S |
| Molecular Weight | 426.37 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | 2-(3-nitrophenyl)-5-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-1,3,4-oxadiazole |
| SMILES | O=[N+]([O-])c1cccc(-c2nnc(CSc3nnc(-c4cccc([N+](=O)[O-])c4)o3)o2)c1 |
| InChI | InChI=1S/C17H10N6O6S/c24-22(25)12-5-1-3-10(7-12)15-19-18-14(28-15)9-30-17-21-20-16(29-17)11-4-2-6-13(8-11)23(26)27/h1-8H,9H2 |
| InChIKey | LADDPDXHPGEFGJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 164.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|