C18H11ClN4O3S — CID 9344969
2-[(2-chloroquinolin-3-yl)methylsulfanyl]-5-(3-nitrophenyl)-1,3,4-oxadiazole (PubChem CID 9344969) has the molecular formula C18H11ClN4O3S and a molecular weight of 398.83 g/mol. Its IUPAC name is 2-[(2-chloroquinolin-3-yl)methylsulfanyl]-5-(3-nitrophenyl)-1,3,4-oxadiazole.
| Compound Name | 2-[(2-chloroquinolin-3-yl)methylsulfanyl]-5-(3-nitrophenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 9344969 |
| Molecular Formula | C18H11ClN4O3S |
| Molecular Weight | 398.83 g/mol |
| Exact Mass | 398.02 |
| IUPAC Name | 2-[(2-chloroquinolin-3-yl)methylsulfanyl]-5-(3-nitrophenyl)-1,3,4-oxadiazole |
| SMILES | O=[N+]([O-])c1cccc(-c2nnc(SCc3cc4ccccc4nc3Cl)o2)c1 |
| InChI | InChI=1S/C18H11ClN4O3S/c19-16-13(8-11-4-1-2-7-15(11)20-16)10-27-18-22-21-17(26-18)12-5-3-6-14(9-12)23(24)25/h1-9H,10H2 |
| InChIKey | BZZHOYLVGRLNAS-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 94.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.83 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|