C15H10N4O5S — CID 9344233
2-(3-nitrophenyl)-5-[(2-nitrophenyl)methylsulfanyl]-1,3,4-oxadiazole (PubChem CID 9344233) has the molecular formula C15H10N4O5S and a molecular weight of 358.34 g/mol. Its IUPAC name is 2-(3-nitrophenyl)-5-[(2-nitrophenyl)methylsulfanyl]-1,3,4-oxadiazole.
| Compound Name | 2-(3-nitrophenyl)-5-[(2-nitrophenyl)methylsulfanyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 9344233 |
| Molecular Formula | C15H10N4O5S |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 2-(3-nitrophenyl)-5-[(2-nitrophenyl)methylsulfanyl]-1,3,4-oxadiazole |
| SMILES | O=[N+]([O-])c1cccc(-c2nnc(SCc3ccccc3[N+](=O)[O-])o2)c1 |
| InChI | InChI=1S/C15H10N4O5S/c20-18(21)12-6-3-5-10(8-12)14-16-17-15(24-14)25-9-11-4-1-2-7-13(11)19(22)23/h1-8H,9H2 |
| InChIKey | OIGBVDBQNSRMPF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 125.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|