C17H11N5O4S2 — CID 4209894
N-(1,3-benzothiazol-2-yl)-2-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide (PubChem CID 4209894) has the molecular formula C17H11N5O4S2 and a molecular weight of 413.44 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 4209894 |
| Molecular Formula | C17H11N5O4S2 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nnc(-c2cccc([N+](=O)[O-])c2)o1)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H11N5O4S2/c23-14(19-16-18-12-6-1-2-7-13(12)28-16)9-27-17-21-20-15(26-17)10-4-3-5-11(8-10)22(24)25/h1-8H,9H2,(H,18,19,23) |
| InChIKey | ARAJOQHSDPUSTQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 124.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|