C15H9N5O4S2 — CID 30777574
2-(4-nitrophenyl)-5-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]-1,3,4-oxadiazole (PubChem CID 30777574) has the molecular formula C15H9N5O4S2 and a molecular weight of 387.40 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-5-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]-1,3,4-oxadiazole.
| Compound Name | 2-(4-nitrophenyl)-5-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 30777574 |
| Molecular Formula | C15H9N5O4S2 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | 2-(4-nitrophenyl)-5-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]-1,3,4-oxadiazole |
| SMILES | O=[N+]([O-])c1ccc(-c2nnc(CSc3nnc(-c4cccs4)o3)o2)cc1 |
| InChI | InChI=1S/C15H9N5O4S2/c21-20(22)10-5-3-9(4-6-10)13-17-16-12(23-13)8-26-15-19-18-14(24-15)11-2-1-7-25-11/h1-7H,8H2 |
| InChIKey | HMDAFNMGWXINMV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 120.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|