C14H7N5O7 — CID 21205474
2-(3,5-dinitrophenyl)-5-(3-nitrophenyl)-1,3,4-oxadiazole (PubChem CID 21205474) has the molecular formula C14H7N5O7 and a molecular weight of 357.24 g/mol. Its IUPAC name is 2-(3,5-dinitrophenyl)-5-(3-nitrophenyl)-1,3,4-oxadiazole.
| Compound Name | 2-(3,5-dinitrophenyl)-5-(3-nitrophenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 21205474 |
| Molecular Formula | C14H7N5O7 |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | 2-(3,5-dinitrophenyl)-5-(3-nitrophenyl)-1,3,4-oxadiazole |
| SMILES | O=[N+]([O-])c1cccc(-c2nnc(-c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)o2)c1 |
| InChI | InChI=1S/C14H7N5O7/c20-17(21)10-3-1-2-8(4-10)13-15-16-14(26-13)9-5-11(18(22)23)7-12(6-9)19(24)25/h1-7H |
| InChIKey | JMNKQZZHOPLJOU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 168.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|