C26H17N5O5 — CID 102044178
4-[5-(3,5-dinitrophenyl)-1,3,4-oxadiazol-2-yl]-N,N-diphenylaniline (PubChem CID 102044178) has the molecular formula C26H17N5O5 and a molecular weight of 479.45 g/mol. Its IUPAC name is 4-[5-(3,5-dinitrophenyl)-1,3,4-oxadiazol-2-yl]-N,N-diphenylaniline.
| Compound Name | 4-[5-(3,5-dinitrophenyl)-1,3,4-oxadiazol-2-yl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 102044178 |
| Molecular Formula | C26H17N5O5 |
| Molecular Weight | 479.45 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | 4-[5-(3,5-dinitrophenyl)-1,3,4-oxadiazol-2-yl]-N,N-diphenylaniline |
| SMILES | O=[N+]([O-])c1cc(-c2nnc(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)o2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H17N5O5/c32-30(33)23-15-19(16-24(17-23)31(34)35)26-28-27-25(36-26)18-11-13-22(14-12-18)29(20-7-3-1-4-8-20)21-9-5-2-6-10-21/h1-17H |
| InChIKey | PZNQIVNIEGQKBG-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 128.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.45 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|