C23H17N3O6 — CID 2650274
methyl 3-nitro-5-[5-[4-(phenoxymethyl)phenyl]-1,3,4-oxadiazol-2-yl]benzoate (PubChem CID 2650274) has the molecular formula C23H17N3O6 and a molecular weight of 431.40 g/mol. Its IUPAC name is methyl 3-nitro-5-[5-[4-(phenoxymethyl)phenyl]-1,3,4-oxadiazol-2-yl]benzoate.
| Compound Name | methyl 3-nitro-5-[5-[4-(phenoxymethyl)phenyl]-1,3,4-oxadiazol-2-yl]benzoate |
|---|---|
| PubChem CID | 2650274 |
| Molecular Formula | C23H17N3O6 |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | methyl 3-nitro-5-[5-[4-(phenoxymethyl)phenyl]-1,3,4-oxadiazol-2-yl]benzoate |
| SMILES | COC(=O)c1cc(-c2nnc(-c3ccc(COc4ccccc4)cc3)o2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H17N3O6/c1-30-23(27)18-11-17(12-19(13-18)26(28)29)22-25-24-21(32-22)16-9-7-15(8-10-16)14-31-20-5-3-2-4-6-20/h2-13H,14H2,1H3 |
| InChIKey | PZORMDSMNJCQTG-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 117.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|