C28H18ClN3O6 — CID 4308541
[4-(2-chloro-4-nitrophenoxy)phenyl]methyl 4-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoate (PubChem CID 4308541) has the molecular formula C28H18ClN3O6 and a molecular weight of 527.92 g/mol. Its IUPAC name is [4-(2-chloro-4-nitrophenoxy)phenyl]methyl 4-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoate.
| Compound Name | [4-(2-chloro-4-nitrophenoxy)phenyl]methyl 4-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoate |
|---|---|
| PubChem CID | 4308541 |
| Molecular Formula | C28H18ClN3O6 |
| Molecular Weight | 527.92 g/mol |
| Exact Mass | 527.09 |
| IUPAC Name | [4-(2-chloro-4-nitrophenoxy)phenyl]methyl 4-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoate |
| SMILES | O=C(OCc1ccc(Oc2ccc([N+](=O)[O-])cc2Cl)cc1)c1ccc(-c2nnc(-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C28H18ClN3O6/c29-24-16-22(32(34)35)12-15-25(24)37-23-13-6-18(7-14-23)17-36-28(33)21-10-8-20(9-11-21)27-31-30-26(38-27)19-4-2-1-3-5-19/h1-16H,17H2 |
| InChIKey | RTNVAJNLXMVGNA-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 117.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.92 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|