C20H14Br2N2O7 — CID 19448964
methyl 4-[[5-[(2,6-dibromo-4-nitrophenyl)carbamoyl]furan-2-yl]methoxy]benzoate (PubChem CID 19448964) has the molecular formula C20H14Br2N2O7 and a molecular weight of 554.15 g/mol. Its IUPAC name is methyl 4-[[5-[(2,6-dibromo-4-nitrophenyl)carbamoyl]furan-2-yl]methoxy]benzoate.
| Compound Name | methyl 4-[[5-[(2,6-dibromo-4-nitrophenyl)carbamoyl]furan-2-yl]methoxy]benzoate |
|---|---|
| PubChem CID | 19448964 |
| Molecular Formula | C20H14Br2N2O7 |
| Molecular Weight | 554.15 g/mol |
| Exact Mass | 551.92 |
| IUPAC Name | methyl 4-[[5-[(2,6-dibromo-4-nitrophenyl)carbamoyl]furan-2-yl]methoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCc2ccc(C(=O)Nc3c(Br)cc([N+](=O)[O-])cc3Br)o2)cc1 |
| InChI | InChI=1S/C20H14Br2N2O7/c1-29-20(26)11-2-4-13(5-3-11)30-10-14-6-7-17(31-14)19(25)23-18-15(21)8-12(24(27)28)9-16(18)22/h2-9H,10H2,1H3,(H,23,25) |
| InChIKey | WEEZVEUYLHMGGU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 120.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.15 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|