C14H8IN3O4 — CID 1259930
2-[5-(3-iodo-5-nitrophenyl)-1,3,4-oxadiazol-2-yl]phenol (PubChem CID 1259930) has the molecular formula C14H8IN3O4 and a molecular weight of 409.14 g/mol. Its IUPAC name is 2-[5-(3-iodo-5-nitrophenyl)-1,3,4-oxadiazol-2-yl]phenol.
| Compound Name | 2-[5-(3-iodo-5-nitrophenyl)-1,3,4-oxadiazol-2-yl]phenol |
|---|---|
| PubChem CID | 1259930 |
| Molecular Formula | C14H8IN3O4 |
| Molecular Weight | 409.14 g/mol |
| Exact Mass | 408.96 |
| IUPAC Name | 2-[5-(3-iodo-5-nitrophenyl)-1,3,4-oxadiazol-2-yl]phenol |
| SMILES | O=[N+]([O-])c1cc(I)cc(-c2nnc(-c3ccccc3O)o2)c1 |
| InChI | InChI=1S/C14H8IN3O4/c15-9-5-8(6-10(7-9)18(20)21)13-16-17-14(22-13)11-3-1-2-4-12(11)19/h1-7,19H |
| InChIKey | MTMCXQDBTYMLQT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.14 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|