C21H13N5O5 — CID 135499486
4-[5-[2-(6-nitro-1H-benzimidazol-2-yl)phenyl]-1,3,4-oxadiazol-2-yl]benzene-1,3-diol (PubChem CID 135499486) has the molecular formula C21H13N5O5 and a molecular weight of 415.37 g/mol. Its IUPAC name is 4-[5-[2-(6-nitro-1H-benzimidazol-2-yl)phenyl]-1,3,4-oxadiazol-2-yl]benzene-1,3-diol.
| Compound Name | 4-[5-[2-(6-nitro-1H-benzimidazol-2-yl)phenyl]-1,3,4-oxadiazol-2-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 135499486 |
| Molecular Formula | C21H13N5O5 |
| Molecular Weight | 415.37 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 4-[5-[2-(6-nitro-1H-benzimidazol-2-yl)phenyl]-1,3,4-oxadiazol-2-yl]benzene-1,3-diol |
| SMILES | O=[N+]([O-])c1ccc2nc(-c3ccccc3-c3nnc(-c4ccc(O)cc4O)o3)[nH]c2c1 |
| InChI | InChI=1S/C21H13N5O5/c27-12-6-7-15(18(28)10-12)21-25-24-20(31-21)14-4-2-1-3-13(14)19-22-16-8-5-11(26(29)30)9-17(16)23-19/h1-10,27-28H,(H,22,23) |
| InChIKey | GAONAEXNFOEILO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 151.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|