C26H18N6O3 — CID 177450636
2-[[2-(1H-benzimidazol-2-yl)phenyl]iminomethyl]-4-[(4-nitrophenyl)diazenyl]phenol (PubChem CID 177450636) has the molecular formula C26H18N6O3 and a molecular weight of 462.47 g/mol. Its IUPAC name is 2-[[2-(1H-benzimidazol-2-yl)phenyl]iminomethyl]-4-[(4-nitrophenyl)diazenyl]phenol.
| Compound Name | 2-[[2-(1H-benzimidazol-2-yl)phenyl]iminomethyl]-4-[(4-nitrophenyl)diazenyl]phenol |
|---|---|
| PubChem CID | 177450636 |
| Molecular Formula | C26H18N6O3 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 2-[[2-(1H-benzimidazol-2-yl)phenyl]iminomethyl]-4-[(4-nitrophenyl)diazenyl]phenol |
| SMILES | O=[N+]([O-])c1ccc(/N=N/c2ccc(O)c(/C=N/c3ccccc3-c3nc4ccccc4[nH]3)c2)cc1 |
| InChI | InChI=1S/C26H18N6O3/c33-25-14-11-19(31-30-18-9-12-20(13-10-18)32(34)35)15-17(25)16-27-22-6-2-1-5-21(22)26-28-23-7-3-4-8-24(23)29-26/h1-16,33H,(H,28,29)/b27-16+,31-30+ |
| InChIKey | IOCSGQWHPYEWHG-ZOXTYVOXSA-N |
| XLogP | 7.01 |
| TPSA | 129.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|