C15H11N5O4 — CID 171979348
3-[(2E)-2-[(2-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]-1H-quinoxalin-2-one (PubChem CID 171979348) has the molecular formula C15H11N5O4 and a molecular weight of 325.28 g/mol. Its IUPAC name is 3-[(2E)-2-[(2-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]-1H-quinoxalin-2-one.
| Compound Name | 3-[(2E)-2-[(2-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 171979348 |
| Molecular Formula | C15H11N5O4 |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 3-[(2E)-2-[(2-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]-1H-quinoxalin-2-one |
| SMILES | O=c1[nH]c2ccccc2nc1N/N=C/c1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C15H11N5O4/c21-13-6-5-10(20(23)24)7-9(13)8-16-19-14-15(22)18-12-4-2-1-3-11(12)17-14/h1-8,21H,(H,17,19)(H,18,22)/b16-8+ |
| InChIKey | KKVHPYQZUOFGQF-LZYBPNLTSA-N |
| XLogP | 1.98 |
| TPSA | 133.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|