C19H13N5O4 — CID 136719030
3-[(2Z)-2-[(2-hydroxy-6-nitronaphthalen-1-yl)methylidene]hydrazinyl]-1H-quinoxalin-2-one (PubChem CID 136719030) has the molecular formula C19H13N5O4 and a molecular weight of 375.34 g/mol. Its IUPAC name is 3-[(2Z)-2-[(2-hydroxy-6-nitronaphthalen-1-yl)methylidene]hydrazinyl]-1H-quinoxalin-2-one.
| Compound Name | 3-[(2Z)-2-[(2-hydroxy-6-nitronaphthalen-1-yl)methylidene]hydrazinyl]-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 136719030 |
| Molecular Formula | C19H13N5O4 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 3-[(2Z)-2-[(2-hydroxy-6-nitronaphthalen-1-yl)methylidene]hydrazinyl]-1H-quinoxalin-2-one |
| SMILES | O=c1[nH]c2ccccc2nc1N/N=C\c1c(O)ccc2cc([N+](=O)[O-])ccc12 |
| InChI | InChI=1S/C19H13N5O4/c25-17-8-5-11-9-12(24(27)28)6-7-13(11)14(17)10-20-23-18-19(26)22-16-4-2-1-3-15(16)21-18/h1-10,25H,(H,21,23)(H,22,26)/b20-10- |
| InChIKey | LNAJSQYRZSRGJL-JMIUGGIZSA-N |
| XLogP | 3.14 |
| TPSA | 133.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|