C24H15N3O3S — CID 2297632
1-[[4-(1,3-benzothiazol-2-yl)phenyl]iminomethyl]-6-nitronaphthalen-2-ol (PubChem CID 2297632) has the molecular formula C24H15N3O3S and a molecular weight of 425.47 g/mol. Its IUPAC name is 1-[[4-(1,3-benzothiazol-2-yl)phenyl]iminomethyl]-6-nitronaphthalen-2-ol.
| Compound Name | 1-[[4-(1,3-benzothiazol-2-yl)phenyl]iminomethyl]-6-nitronaphthalen-2-ol |
|---|---|
| PubChem CID | 2297632 |
| Molecular Formula | C24H15N3O3S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 1-[[4-(1,3-benzothiazol-2-yl)phenyl]iminomethyl]-6-nitronaphthalen-2-ol |
| SMILES | O=[N+]([O-])c1ccc2c(/C=N/c3ccc(-c4nc5ccccc5s4)cc3)c(O)ccc2c1 |
| InChI | InChI=1S/C24H15N3O3S/c28-22-12-7-16-13-18(27(29)30)10-11-19(16)20(22)14-25-17-8-5-15(6-9-17)24-26-21-3-1-2-4-23(21)31-24/h1-14,28H/b25-14+ |
| InChIKey | DDOQPJADAIXFGV-AFUMVMLFSA-N |
| XLogP | 6.48 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|