C20H12BrClN2OS — CID 3472912
2-[[4-(1,3-benzothiazol-2-yl)phenyl]iminomethyl]-4-bromo-6-chlorophenol (PubChem CID 3472912) has the molecular formula C20H12BrClN2OS and a molecular weight of 443.75 g/mol. Its IUPAC name is 2-[[4-(1,3-benzothiazol-2-yl)phenyl]iminomethyl]-4-bromo-6-chlorophenol.
| Compound Name | 2-[[4-(1,3-benzothiazol-2-yl)phenyl]iminomethyl]-4-bromo-6-chlorophenol |
|---|---|
| PubChem CID | 3472912 |
| Molecular Formula | C20H12BrClN2OS |
| Molecular Weight | 443.75 g/mol |
| Exact Mass | 441.95 |
| IUPAC Name | 2-[[4-(1,3-benzothiazol-2-yl)phenyl]iminomethyl]-4-bromo-6-chlorophenol |
| SMILES | Oc1c(Cl)cc(Br)cc1/C=N/c1ccc(-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C20H12BrClN2OS/c21-14-9-13(19(25)16(22)10-14)11-23-15-7-5-12(6-8-15)20-24-17-3-1-2-4-18(17)26-20/h1-11,25H/b23-11+ |
| InChIKey | FLLYMRITOFJGNC-FOKLQQMPSA-N |
| XLogP | 6.84 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.75 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|