C20H12Br2N2O2S — CID 4029945
2-[[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]iminomethyl]-4,6-dibromophenol (PubChem CID 4029945) has the molecular formula C20H12Br2N2O2S and a molecular weight of 504.20 g/mol. Its IUPAC name is 2-[[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]iminomethyl]-4,6-dibromophenol.
| Compound Name | 2-[[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]iminomethyl]-4,6-dibromophenol |
|---|---|
| PubChem CID | 4029945 |
| Molecular Formula | C20H12Br2N2O2S |
| Molecular Weight | 504.20 g/mol |
| Exact Mass | 501.90 |
| IUPAC Name | 2-[[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]iminomethyl]-4,6-dibromophenol |
| SMILES | Oc1ccc(/N=C/c2cc(Br)cc(Br)c2O)cc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C20H12Br2N2O2S/c21-12-7-11(19(26)15(22)8-12)10-23-13-5-6-17(25)14(9-13)20-24-16-3-1-2-4-18(16)27-20/h1-10,25-26H/b23-10+ |
| InChIKey | WIYGTLSXYFERNI-AUEPDCJTSA-N |
| XLogP | 6.65 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.20 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|