C22H16BrClN2O2S — CID 4035583
2-[[4-(1,3-benzothiazol-2-yl)-3-hydroxyphenyl]iminomethyl]-6-bromo-4-chloro-3,5-dimethylphenol (PubChem CID 4035583) has the molecular formula C22H16BrClN2O2S and a molecular weight of 487.81 g/mol. Its IUPAC name is 2-[[4-(1,3-benzothiazol-2-yl)-3-hydroxyphenyl]iminomethyl]-6-bromo-4-chloro-3,5-dimethylphenol.
| Compound Name | 2-[[4-(1,3-benzothiazol-2-yl)-3-hydroxyphenyl]iminomethyl]-6-bromo-4-chloro-3,5-dimethylphenol |
|---|---|
| PubChem CID | 4035583 |
| Molecular Formula | C22H16BrClN2O2S |
| Molecular Weight | 487.81 g/mol |
| Exact Mass | 485.98 |
| IUPAC Name | 2-[[4-(1,3-benzothiazol-2-yl)-3-hydroxyphenyl]iminomethyl]-6-bromo-4-chloro-3,5-dimethylphenol |
| SMILES | Cc1c(Cl)c(C)c(/C=N/c2ccc(-c3nc4ccccc4s3)c(O)c2)c(O)c1Br |
| InChI | InChI=1S/C22H16BrClN2O2S/c1-11-15(21(28)19(23)12(2)20(11)24)10-25-13-7-8-14(17(27)9-13)22-26-16-5-3-4-6-18(16)29-22/h3-10,27-28H,1-2H3/b25-10+ |
| InChIKey | XLVXFWRSTJUAAK-KIBLKLHPSA-N |
| XLogP | 7.16 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.81 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|