C27H17BrN2O3S — CID 3096174
(3-bromophenyl) 4-[[4-(1,3-benzothiazol-2-yl)-3-hydroxyphenyl]iminomethyl]benzoate (PubChem CID 3096174) has the molecular formula C27H17BrN2O3S and a molecular weight of 529.42 g/mol. Its IUPAC name is (3-bromophenyl) 4-[[4-(1,3-benzothiazol-2-yl)-3-hydroxyphenyl]iminomethyl]benzoate.
| Compound Name | (3-bromophenyl) 4-[[4-(1,3-benzothiazol-2-yl)-3-hydroxyphenyl]iminomethyl]benzoate |
|---|---|
| PubChem CID | 3096174 |
| Molecular Formula | C27H17BrN2O3S |
| Molecular Weight | 529.42 g/mol |
| Exact Mass | 528.01 |
| IUPAC Name | (3-bromophenyl) 4-[[4-(1,3-benzothiazol-2-yl)-3-hydroxyphenyl]iminomethyl]benzoate |
| SMILES | O=C(Oc1cccc(Br)c1)c1ccc(/C=N/c2ccc(-c3nc4ccccc4s3)c(O)c2)cc1 |
| InChI | InChI=1S/C27H17BrN2O3S/c28-19-4-3-5-21(14-19)33-27(32)18-10-8-17(9-11-18)16-29-20-12-13-22(24(31)15-20)26-30-23-6-1-2-7-25(23)34-26/h1-16,31H/b29-16+ |
| InChIKey | RMQARSBLODKAKB-MUFRIFMGSA-N |
| XLogP | 7.40 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.42 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|