C20H13IN2O2S — CID 5074919
2-[[4-(1,3-benzothiazol-2-yl)-3-hydroxyphenyl]iminomethyl]-6-iodophenol (PubChem CID 5074919) has the molecular formula C20H13IN2O2S and a molecular weight of 472.31 g/mol. Its IUPAC name is 2-[[4-(1,3-benzothiazol-2-yl)-3-hydroxyphenyl]iminomethyl]-6-iodophenol.
| Compound Name | 2-[[4-(1,3-benzothiazol-2-yl)-3-hydroxyphenyl]iminomethyl]-6-iodophenol |
|---|---|
| PubChem CID | 5074919 |
| Molecular Formula | C20H13IN2O2S |
| Molecular Weight | 472.31 g/mol |
| Exact Mass | 471.97 |
| IUPAC Name | 2-[[4-(1,3-benzothiazol-2-yl)-3-hydroxyphenyl]iminomethyl]-6-iodophenol |
| SMILES | Oc1cc(/N=C/c2cccc(I)c2O)ccc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C20H13IN2O2S/c21-15-5-3-4-12(19(15)25)11-22-13-8-9-14(17(24)10-13)20-23-16-6-1-2-7-18(16)26-20/h1-11,24-25H/b22-11+ |
| InChIKey | WVKBGAAGDDRUHT-SSDVNMTOSA-N |
| XLogP | 5.73 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.31 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|