C20H13ClN2OS — CID 3674145
2-[[3-(1,3-benzothiazol-2-yl)-4-chlorophenyl]iminomethyl]phenol (PubChem CID 3674145) has the molecular formula C20H13ClN2OS and a molecular weight of 364.86 g/mol. Its IUPAC name is 2-[[3-(1,3-benzothiazol-2-yl)-4-chlorophenyl]iminomethyl]phenol.
| Compound Name | 2-[[3-(1,3-benzothiazol-2-yl)-4-chlorophenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 3674145 |
| Molecular Formula | C20H13ClN2OS |
| Molecular Weight | 364.86 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 2-[[3-(1,3-benzothiazol-2-yl)-4-chlorophenyl]iminomethyl]phenol |
| SMILES | Oc1ccccc1/C=N/c1ccc(Cl)c(-c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C20H13ClN2OS/c21-16-10-9-14(22-12-13-5-1-3-7-18(13)24)11-15(16)20-23-17-6-2-4-8-19(17)25-20/h1-12,24H/b22-12+ |
| InChIKey | ZMTSWVJBPCMIMD-WSDLNYQXSA-N |
| XLogP | 6.07 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.86 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|