C21H15BrN2O2S — CID 4077405
2-(1,3-benzothiazol-2-yl)-4-[(3-bromo-4-methoxyphenyl)methylideneamino]phenol (PubChem CID 4077405) has the molecular formula C21H15BrN2O2S and a molecular weight of 439.33 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-4-[(3-bromo-4-methoxyphenyl)methylideneamino]phenol.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-4-[(3-bromo-4-methoxyphenyl)methylideneamino]phenol |
|---|---|
| PubChem CID | 4077405 |
| Molecular Formula | C21H15BrN2O2S |
| Molecular Weight | 439.33 g/mol |
| Exact Mass | 438.00 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-4-[(3-bromo-4-methoxyphenyl)methylideneamino]phenol |
| SMILES | COc1ccc(/C=N/c2ccc(O)c(-c3nc4ccccc4s3)c2)cc1Br |
| InChI | InChI=1S/C21H15BrN2O2S/c1-26-19-9-6-13(10-16(19)22)12-23-14-7-8-18(25)15(11-14)21-24-17-4-2-3-5-20(17)27-21/h2-12,25H,1H3/b23-12+ |
| InChIKey | XPUJOBRGAJEGEO-FSJBWODESA-N |
| XLogP | 6.19 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.33 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|