C23H18BrClN2O3 — CID 171980803
2-bromo-4-chloro-6-[[4-hydroxy-3-(6-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]-3,5-dimethylphenol (PubChem CID 171980803) has the molecular formula C23H18BrClN2O3 and a molecular weight of 485.77 g/mol. Its IUPAC name is 2-bromo-4-chloro-6-[[4-hydroxy-3-(6-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]-3,5-dimethylphenol.
| Compound Name | 2-bromo-4-chloro-6-[[4-hydroxy-3-(6-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]-3,5-dimethylphenol |
|---|---|
| PubChem CID | 171980803 |
| Molecular Formula | C23H18BrClN2O3 |
| Molecular Weight | 485.77 g/mol |
| Exact Mass | 484.02 |
| IUPAC Name | 2-bromo-4-chloro-6-[[4-hydroxy-3-(6-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]-3,5-dimethylphenol |
| SMILES | Cc1ccc2nc(-c3cc(/N=C/c4c(C)c(Cl)c(C)c(Br)c4O)ccc3O)oc2c1 |
| InChI | InChI=1S/C23H18BrClN2O3/c1-11-4-6-17-19(8-11)30-23(27-17)15-9-14(5-7-18(15)28)26-10-16-12(2)21(25)13(3)20(24)22(16)29/h4-10,28-29H,1-3H3/b26-10+ |
| InChIKey | IRBFUCZZXLTFRB-NSKAYECMSA-N |
| XLogP | 7.00 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.77 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|