C25H18N2O2 — CID 135633863
1-[[2-(3-methylphenyl)-1,3-benzoxazol-6-yl]iminomethyl]naphthalen-2-ol (PubChem CID 135633863) has the molecular formula C25H18N2O2 and a molecular weight of 378.43 g/mol. Its IUPAC name is 1-[[2-(3-methylphenyl)-1,3-benzoxazol-6-yl]iminomethyl]naphthalen-2-ol.
| Compound Name | 1-[[2-(3-methylphenyl)-1,3-benzoxazol-6-yl]iminomethyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 135633863 |
| Molecular Formula | C25H18N2O2 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 1-[[2-(3-methylphenyl)-1,3-benzoxazol-6-yl]iminomethyl]naphthalen-2-ol |
| SMILES | Cc1cccc(-c2nc3ccc(/N=C/c4c(O)ccc5ccccc45)cc3o2)c1 |
| InChI | InChI=1S/C25H18N2O2/c1-16-5-4-7-18(13-16)25-27-22-11-10-19(14-24(22)29-25)26-15-21-20-8-3-2-6-17(20)9-12-23(21)28/h2-15,28H,1H3/b26-15+ |
| InChIKey | SPSRNQMTWWXGLW-CVKSISIWSA-N |
| XLogP | 6.41 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|