C29H21NO2 — CID 136702067
1-[(4-hydroxy-3,5-diphenylphenyl)iminomethyl]naphthalen-2-ol (PubChem CID 136702067) has the molecular formula C29H21NO2 and a molecular weight of 415.49 g/mol. Its IUPAC name is 1-[(4-hydroxy-3,5-diphenylphenyl)iminomethyl]naphthalen-2-ol.
| Compound Name | 1-[(4-hydroxy-3,5-diphenylphenyl)iminomethyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 136702067 |
| Molecular Formula | C29H21NO2 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 1-[(4-hydroxy-3,5-diphenylphenyl)iminomethyl]naphthalen-2-ol |
| SMILES | Oc1ccc2ccccc2c1/C=N/c1cc(-c2ccccc2)c(O)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C29H21NO2/c31-28-16-15-22-13-7-8-14-24(22)27(28)19-30-23-17-25(20-9-3-1-4-10-20)29(32)26(18-23)21-11-5-2-6-12-21/h1-19,31-32H/b30-19+ |
| InChIKey | HJWWYIGVEXYRFT-NDZAJKAJSA-N |
| XLogP | 7.34 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|