C17H11Cl2NO2 — CID 630306
1-[(3,5-dichloro-4-hydroxyphenyl)iminomethyl]naphthalen-2-ol (PubChem CID 630306) has the molecular formula C17H11Cl2NO2 and a molecular weight of 332.19 g/mol. Its IUPAC name is 1-[(3,5-dichloro-4-hydroxyphenyl)iminomethyl]naphthalen-2-ol.
| Compound Name | 1-[(3,5-dichloro-4-hydroxyphenyl)iminomethyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 630306 |
| Molecular Formula | C17H11Cl2NO2 |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 1-[(3,5-dichloro-4-hydroxyphenyl)iminomethyl]naphthalen-2-ol |
| SMILES | Oc1ccc2ccccc2c1/C=N/c1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C17H11Cl2NO2/c18-14-7-11(8-15(19)17(14)22)20-9-13-12-4-2-1-3-10(12)5-6-16(13)21/h1-9,21-22H/b20-9+ |
| InChIKey | RZAKRQVLHRBGJV-AWQFTUOYSA-N |
| XLogP | 5.31 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|