C36H36N6O3 — CID 159705468
1-[(3,5-diamino-4-methylphenyl)iminomethyl]naphthalen-2-ol;2-hydroxynaphthalene-1-carbaldehyde;2-methylbenzene-1,3,5-triamine (PubChem CID 159705468) has the molecular formula C36H36N6O3 and a molecular weight of 600.72 g/mol. Its IUPAC name is 1-[(3,5-diamino-4-methylphenyl)iminomethyl]naphthalen-2-ol;2-hydroxynaphthalene-1-carbaldehyde;2-methylbenzene-1,3,5-triamine.
| Compound Name | 1-[(3,5-diamino-4-methylphenyl)iminomethyl]naphthalen-2-ol;2-hydroxynaphthalene-1-carbaldehyde;2-methylbenzene-1,3,5-triamine |
|---|---|
| PubChem CID | 159705468 |
| Molecular Formula | C36H36N6O3 |
| Molecular Weight | 600.72 g/mol |
| Exact Mass | 600.28 |
| IUPAC Name | 1-[(3,5-diamino-4-methylphenyl)iminomethyl]naphthalen-2-ol;2-hydroxynaphthalene-1-carbaldehyde;2-methylbenzene-1,3,5-triamine |
| SMILES | Cc1c(N)cc(/N=C/c2c(O)ccc3ccccc23)cc1N.Cc1c(N)cc(N)cc1N.O=Cc1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C18H17N3O.C11H8O2.C7H11N3/c1-11-16(19)8-13(9-17(11)20)21-10-15-14-5-3-2-4-12(14)6-7-18(15)22;12-7-10-9-4-2-1-3-8(9)5-6-11(10)13;1-4-6(9)2-5(8)3-7(4)10/h2-10,22H,19-20H2,1H3;1-7,13H;2-3H,8-10H2,1H3/b21-10+;; |
| InChIKey | MYDQDVVQEFVAHM-GDUPHPTFSA-N |
| XLogP | 6.87 |
| TPSA | 199.99 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.72 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|