C20H19NO2 — CID 135713314
1-[(4-propoxyphenyl)iminomethyl]naphthalen-2-ol (PubChem CID 135713314) has the molecular formula C20H19NO2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 1-[(4-propoxyphenyl)iminomethyl]naphthalen-2-ol.
| Compound Name | 1-[(4-propoxyphenyl)iminomethyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 135713314 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 1-[(4-propoxyphenyl)iminomethyl]naphthalen-2-ol |
| SMILES | CCCOc1ccc(/N=C/c2c(O)ccc3ccccc23)cc1 |
| InChI | InChI=1S/C20H19NO2/c1-2-13-23-17-10-8-16(9-11-17)21-14-19-18-6-4-3-5-15(18)7-12-20(19)22/h3-12,14,22H,2,13H2,1H3/b21-14+ |
| InChIKey | VOVPSKYTIAUJBN-KGENOOAVSA-N |
| XLogP | 5.08 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|