C22H17ClN2O2 — CID 4138556
2-[[3-(1,3-benzoxazol-2-yl)phenyl]iminomethyl]-4-chloro-3,5-dimethylphenol (PubChem CID 4138556) has the molecular formula C22H17ClN2O2 and a molecular weight of 376.84 g/mol. Its IUPAC name is 2-[[3-(1,3-benzoxazol-2-yl)phenyl]iminomethyl]-4-chloro-3,5-dimethylphenol.
| Compound Name | 2-[[3-(1,3-benzoxazol-2-yl)phenyl]iminomethyl]-4-chloro-3,5-dimethylphenol |
|---|---|
| PubChem CID | 4138556 |
| Molecular Formula | C22H17ClN2O2 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 2-[[3-(1,3-benzoxazol-2-yl)phenyl]iminomethyl]-4-chloro-3,5-dimethylphenol |
| SMILES | Cc1cc(O)c(/C=N/c2cccc(-c3nc4ccccc4o3)c2)c(C)c1Cl |
| InChI | InChI=1S/C22H17ClN2O2/c1-13-10-19(26)17(14(2)21(13)23)12-24-16-7-5-6-15(11-16)22-25-18-8-3-4-9-20(18)27-22/h3-12,26H,1-2H3/b24-12+ |
| InChIKey | ZOGDNOICSFJTKY-WYMPLXKRSA-N |
| XLogP | 6.22 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|