C22H16Br2N2O3 — CID 5222286
3,4-dibromo-6-methoxy-2-[[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]phenol (PubChem CID 5222286) has the molecular formula C22H16Br2N2O3 and a molecular weight of 516.19 g/mol. Its IUPAC name is 3,4-dibromo-6-methoxy-2-[[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]phenol.
| Compound Name | 3,4-dibromo-6-methoxy-2-[[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 5222286 |
| Molecular Formula | C22H16Br2N2O3 |
| Molecular Weight | 516.19 g/mol |
| Exact Mass | 513.95 |
| IUPAC Name | 3,4-dibromo-6-methoxy-2-[[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]phenol |
| SMILES | COc1cc(Br)c(Br)c(/C=N/c2cccc(-c3nc4cc(C)ccc4o3)c2)c1O |
| InChI | InChI=1S/C22H16Br2N2O3/c1-12-6-7-18-17(8-12)26-22(29-18)13-4-3-5-14(9-13)25-11-15-20(24)16(23)10-19(28-2)21(15)27/h3-11,27H,1-2H3/b25-11+ |
| InChIKey | IKZQGWHWTBHNKD-OPEKNORGSA-N |
| XLogP | 6.79 |
| TPSA | 67.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.19 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|