C23H18Br2N2O3 — CID 3097141
3,4-dibromo-6-ethoxy-2-[[2-(4-methylphenyl)-1,3-benzoxazol-5-yl]iminomethyl]phenol (PubChem CID 3097141) has the molecular formula C23H18Br2N2O3 and a molecular weight of 530.22 g/mol. Its IUPAC name is 3,4-dibromo-6-ethoxy-2-[[2-(4-methylphenyl)-1,3-benzoxazol-5-yl]iminomethyl]phenol.
| Compound Name | 3,4-dibromo-6-ethoxy-2-[[2-(4-methylphenyl)-1,3-benzoxazol-5-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 3097141 |
| Molecular Formula | C23H18Br2N2O3 |
| Molecular Weight | 530.22 g/mol |
| Exact Mass | 527.97 |
| IUPAC Name | 3,4-dibromo-6-ethoxy-2-[[2-(4-methylphenyl)-1,3-benzoxazol-5-yl]iminomethyl]phenol |
| SMILES | CCOc1cc(Br)c(Br)c(/C=N/c2ccc3oc(-c4ccc(C)cc4)nc3c2)c1O |
| InChI | InChI=1S/C23H18Br2N2O3/c1-3-29-20-11-17(24)21(25)16(22(20)28)12-26-15-8-9-19-18(10-15)27-23(30-19)14-6-4-13(2)5-7-14/h4-12,28H,3H2,1-2H3/b26-12+ |
| InChIKey | CHNGAIJQEPNVTJ-RPPGKUMJSA-N |
| XLogP | 7.18 |
| TPSA | 67.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.22 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|