C22H15BrN2O3 — CID 4606666
1-(6-bromo-1,3-benzodioxol-5-yl)-N-[2-(4-methylphenyl)-1,3-benzoxazol-5-yl]methanimine (PubChem CID 4606666) has the molecular formula C22H15BrN2O3 and a molecular weight of 435.28 g/mol. Its IUPAC name is 1-(6-bromo-1,3-benzodioxol-5-yl)-N-[2-(4-methylphenyl)-1,3-benzoxazol-5-yl]methanimine.
| Compound Name | 1-(6-bromo-1,3-benzodioxol-5-yl)-N-[2-(4-methylphenyl)-1,3-benzoxazol-5-yl]methanimine |
|---|---|
| PubChem CID | 4606666 |
| Molecular Formula | C22H15BrN2O3 |
| Molecular Weight | 435.28 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | 1-(6-bromo-1,3-benzodioxol-5-yl)-N-[2-(4-methylphenyl)-1,3-benzoxazol-5-yl]methanimine |
| SMILES | Cc1ccc(-c2nc3cc(/N=C/c4cc5c(cc4Br)OCO5)ccc3o2)cc1 |
| InChI | InChI=1S/C22H15BrN2O3/c1-13-2-4-14(5-3-13)22-25-18-9-16(6-7-19(18)28-22)24-11-15-8-20-21(10-17(15)23)27-12-26-20/h2-11H,12H2,1H3/b24-11+ |
| InChIKey | XKYCQULJVMYWIJ-BHGWPJFGSA-N |
| XLogP | 6.05 |
| TPSA | 56.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.28 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|