C23H18N2O3 — CID 4590942
1-(1,3-benzodioxol-5-yl)-N-[2-(3,4-dimethylphenyl)-1,3-benzoxazol-5-yl]methanimine (PubChem CID 4590942) has the molecular formula C23H18N2O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N-[2-(3,4-dimethylphenyl)-1,3-benzoxazol-5-yl]methanimine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N-[2-(3,4-dimethylphenyl)-1,3-benzoxazol-5-yl]methanimine |
|---|---|
| PubChem CID | 4590942 |
| Molecular Formula | C23H18N2O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N-[2-(3,4-dimethylphenyl)-1,3-benzoxazol-5-yl]methanimine |
| SMILES | Cc1ccc(-c2nc3cc(/N=C/c4ccc5c(c4)OCO5)ccc3o2)cc1C |
| InChI | InChI=1S/C23H18N2O3/c1-14-3-5-17(9-15(14)2)23-25-19-11-18(6-8-20(19)28-23)24-12-16-4-7-21-22(10-16)27-13-26-21/h3-12H,13H2,1-2H3/b24-12+ |
| InChIKey | CMZTUPJUTAAUPE-WYMPLXKRSA-N |
| XLogP | 5.59 |
| TPSA | 56.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|